C28H23N5O4 — CID 90714852
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-[4-(1H-pyrazol-5-yl)phenyl]phenyl]imidazolidine-2,4-dione (PubChem CID 90714852) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-[4-(1H-pyrazol-5-yl)phenyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-[4-(1H-pyrazol-5-yl)phenyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90714852 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-[4-(1H-pyrazol-5-yl)phenyl]phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4ccc(-c5ccc(-c6ccn[nH]6)cc5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C28H23N5O4/c1-37-22-11-8-20-15-33(25(34)23(20)14-22)16-28(26(35)30-27(36)31-28)21-9-6-18(7-10-21)17-2-4-19(5-3-17)24-12-13-29-32-24/h2-15,34H,16H2,1H3,(H,29,32)(H2,30,31,35,36)/t28-/m0/s1 |
| InChIKey | FOEMLMYRMNMATG-NDEPHWFRSA-N |
| XLogP | 4.15 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|