C29H24N4O4 — CID 91571638
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(2-methylquinolin-6-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 91571638) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(2-methylquinolin-6-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(2-methylquinolin-6-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91571638 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(2-methylquinolin-6-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4ccc(-c5ccc6nc(C)ccc6c5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C29H24N4O4/c1-17-3-4-20-13-19(8-12-25(20)30-17)18-5-9-22(10-6-18)29(27(35)31-28(36)32-29)16-33-15-21-7-11-23(37-2)14-24(21)26(33)34/h3-15,34H,16H2,1-2H3,(H2,31,32,35,36)/t29-/m0/s1 |
| InChIKey | IROULUGOFCWYBM-LJAQVGFWSA-N |
| XLogP | 4.61 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|