C32H25N3O4 — CID 91458353
(5S)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-naphthalen-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 91458353) has the molecular formula C32H25N3O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is (5S)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-naphthalen-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-naphthalen-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91458353 |
| Molecular Formula | C32H25N3O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (5S)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-naphthalen-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC#CCOc1ccc2cn(C[C@]3(c4ccc(-c5ccc6ccccc6c5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C32H25N3O4/c1-2-3-16-39-27-15-12-25-19-35(29(36)28(25)18-27)20-32(30(37)33-31(38)34-32)26-13-10-22(11-14-26)24-9-8-21-6-4-5-7-23(21)17-24/h4-15,17-19,36H,16,20H2,1H3,(H2,33,34,37,38)/t32-/m1/s1 |
| InChIKey | FUIQWUZYZRVKRI-JGCGQSQUSA-N |
| XLogP | 5.30 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|