C22H18FN3O4 — CID 91318323
(5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 91318323) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91318323 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CC#CCOc1ccc2cn(C[C@@]3(c4ccc(F)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C22H18FN3O4/c1-2-3-10-30-17-9-4-14-12-26(19(27)18(14)11-17)13-22(20(28)24-21(29)25-22)15-5-7-16(23)8-6-15/h4-9,11-12,27H,10,13H2,1H3,(H2,24,25,28,29)/t22-/m0/s1 |
| InChIKey | PGCWDFFLXBFITC-QFIPXVFZSA-N |
| XLogP | 2.62 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|