C33H31N5O4 — CID 91033485
(5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-[4-[1-(cyclopropylmethyl)-2,3-dihydroindazol-5-yl]phenyl]imidazolidine-2,4-dione (PubChem CID 91033485) has the molecular formula C33H31N5O4 and a molecular weight of 561.64 g/mol. Its IUPAC name is (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-[4-[1-(cyclopropylmethyl)-2,3-dihydroindazol-5-yl]phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-[4-[1-(cyclopropylmethyl)-2,3-dihydroindazol-5-yl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91033485 |
| Molecular Formula | C33H31N5O4 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (5R)-5-[(6-but-2-ynoxy-1-hydroxyisoindol-2-yl)methyl]-5-[4-[1-(cyclopropylmethyl)-2,3-dihydroindazol-5-yl]phenyl]imidazolidine-2,4-dione |
| SMILES | CC#CCOc1ccc2cn(C[C@@]3(c4ccc(-c5ccc6c(c5)CNN6CC5CC5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C33H31N5O4/c1-2-3-14-42-27-12-8-24-19-37(30(39)28(24)16-27)20-33(31(40)35-32(41)36-33)26-10-6-22(7-11-26)23-9-13-29-25(15-23)17-34-38(29)18-21-4-5-21/h6-13,15-16,19,21,34,39H,4-5,14,17-18,20H2,1H3,(H2,35,36,40,41)/t33-/m0/s1 |
| InChIKey | FQMMTNCPVZJIEI-XIFFEERXSA-N |
| XLogP | 4.39 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|