C25H22N4O4 — CID 123880370
(5S)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(3-methyl-2-pyridinyl)phenyl]imidazolidine-2,4-dione (PubChem CID 123880370) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is (5S)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(3-methyl-2-pyridinyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(3-methyl-2-pyridinyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123880370 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (5S)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[4-(3-methyl-2-pyridinyl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@]3(c4ccc(-c5ncccc5C)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C25H22N4O4/c1-15-4-3-11-26-21(15)16-5-8-18(9-6-16)25(23(31)27-24(32)28-25)14-29-13-17-7-10-19(33-2)12-20(17)22(29)30/h3-13,30H,14H2,1-2H3,(H2,27,28,31,32)/t25-/m1/s1 |
| InChIKey | QPHVECFDHQVHJS-RUZDIDTESA-N |
| XLogP | 3.46 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|