C20H16N4O5 — CID 90817815
(5S)-5-furo[2,3-b]pyridin-2-yl-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90817815) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is (5S)-5-furo[2,3-b]pyridin-2-yl-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-furo[2,3-b]pyridin-2-yl-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90817815 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (5S)-5-furo[2,3-b]pyridin-2-yl-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4cc5cccnc5o4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C20H16N4O5/c1-28-13-5-4-12-9-24(17(25)14(12)8-13)10-20(18(26)22-19(27)23-20)15-7-11-3-2-6-21-16(11)29-15/h2-9,25H,10H2,1H3,(H2,22,23,26,27)/t20-/m0/s1 |
| InChIKey | DOIKTGSOEZGLLW-FQEVSTJZSA-N |
| XLogP | 2.23 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|