C19H21N5O4 — CID 90994832
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-(1-propan-2-ylpyrazol-4-yl)imidazolidine-2,4-dione (PubChem CID 90994832) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-(1-propan-2-ylpyrazol-4-yl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-(1-propan-2-ylpyrazol-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90994832 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-(1-propan-2-ylpyrazol-4-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4cnn(C(C)C)c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C19H21N5O4/c1-11(2)24-9-13(7-20-24)19(17(26)21-18(27)22-19)10-23-8-12-4-5-14(28-3)6-15(12)16(23)25/h4-9,11,25H,10H2,1-3H3,(H2,21,22,26,27)/t19-/m0/s1 |
| InChIKey | IAAWKICIVLQCGQ-IBGZPJMESA-N |
| XLogP | 1.87 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|