C25H21N5O5 — CID 91035515
5-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-2-carboxamide (PubChem CID 91035515) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is 5-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-2-carboxamide.
| Compound Name | 5-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91035515 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 5-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-2-carboxamide |
| SMILES | COc1ccc2cn(C[C@@]3(c4ccc(-c5ccc(C(N)=O)nc5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C25H21N5O5/c1-35-18-8-4-16-12-30(22(32)19(16)10-18)13-25(23(33)28-24(34)29-25)17-6-2-14(3-7-17)15-5-9-20(21(26)31)27-11-15/h2-12,32H,13H2,1H3,(H2,26,31)(H2,28,29,33,34)/t25-/m0/s1 |
| InChIKey | OINRCGHJDPXXEE-VWLOTQADSA-N |
| XLogP | 2.25 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|