C27H26N4O4 — CID 90972982
5-[4-[2-(2-aminoethyl)phenyl]phenyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90972982) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 5-[4-[2-(2-aminoethyl)phenyl]phenyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-[2-(2-aminoethyl)phenyl]phenyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90972982 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-[4-[2-(2-aminoethyl)phenyl]phenyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(CC3(c4ccc(-c5ccccc5CCN)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C27H26N4O4/c1-35-21-11-8-19-15-31(24(32)23(19)14-21)16-27(25(33)29-26(34)30-27)20-9-6-18(7-10-20)22-5-3-2-4-17(22)12-13-28/h2-11,14-15,32H,12-13,16,28H2,1H3,(H2,29,30,33,34) |
| InChIKey | ZOZKGUOEIWEATK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|