C25H22N4O6S — CID 91410877
4-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide (PubChem CID 91410877) has the molecular formula C25H22N4O6S and a molecular weight of 506.54 g/mol. Its IUPAC name is 4-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91410877 |
| Molecular Formula | C25H22N4O6S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 4-[4-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc2cn(C[C@@]3(c4ccc(-c5ccc(S(N)(=O)=O)cc5)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C25H22N4O6S/c1-35-19-9-4-17-13-29(22(30)21(17)12-19)14-25(23(31)27-24(32)28-25)18-7-2-15(3-8-18)16-5-10-20(11-6-16)36(26,33)34/h2-13,30H,14H2,1H3,(H2,26,33,34)(H2,27,28,31,32)/t25-/m0/s1 |
| InChIKey | ALFMJAWVTFNOON-VWLOTQADSA-N |
| XLogP | 2.40 |
| TPSA | 152.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|