C19H17N3O5 — CID 91518354
5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-hydroxyphenyl)imidazolidine-2,4-dione (PubChem CID 91518354) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-hydroxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91518354 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(O)n(CC3(c4ccc(O)cc4)NC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C19H17N3O5/c1-27-14-6-7-15-11(8-14)9-22(16(15)24)10-19(17(25)20-18(26)21-19)12-2-4-13(23)5-3-12/h2-9,23-24H,10H2,1H3,(H2,20,21,25,26) |
| InChIKey | QXFOXXSPNWMAIF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|