C18H22N4O4 — CID 91071298
5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione (PubChem CID 91071298) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91071298 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-piperidin-4-ylimidazolidine-2,4-dione |
| SMILES | COc1ccc2c(O)n(CC3(C4CCNCC4)NC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C18H22N4O4/c1-26-13-2-3-14-11(8-13)9-22(15(14)23)10-18(12-4-6-19-7-5-12)16(24)20-17(25)21-18/h2-3,8-9,12,19,23H,4-7,10H2,1H3,(H2,20,21,24,25) |
| InChIKey | WHCXDHQAEBILSE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|