C24H23N3O6 — CID 91150550
3,3-bis[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 91150550) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 3,3-bis[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3,3-bis[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 91150550 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3,3-bis[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(O)n(CC3(Cn4cc5cc(OC)ccc5c4O)CC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C24H23N3O6/c1-32-16-3-5-18-14(7-16)10-26(21(18)29)12-24(9-20(28)25-23(24)31)13-27-11-15-8-17(33-2)4-6-19(15)22(27)30/h3-8,10-11,29-30H,9,12-13H2,1-2H3,(H,25,28,31) |
| InChIKey | GUXMNWFJZPTJON-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|