C23H19N5O4 — CID 91337439
(5R)-5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 91337439) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91337439 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (5R)-5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(4-pyrazin-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(O)n(C[C@@]3(c4ccc(-c5cnccn5)cc4)NC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C23H19N5O4/c1-32-17-6-7-18-15(10-17)12-28(20(18)29)13-23(21(30)26-22(31)27-23)16-4-2-14(3-5-16)19-11-24-8-9-25-19/h2-12,29H,13H2,1H3,(H2,26,27,30,31)/t23-/m0/s1 |
| InChIKey | FKRSFYFBNKYODG-QHCPKHFHSA-N |
| XLogP | 2.55 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|