C28H28N4O6S — CID 91266867
5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)imidazolidine-2,4-dione (PubChem CID 91266867) has the molecular formula C28H28N4O6S and a molecular weight of 548.62 g/mol. Its IUPAC name is 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91266867 |
| Molecular Formula | C28H28N4O6S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 5-[(1-hydroxy-5-methoxyisoindol-2-yl)methyl]-5-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(O)n(CC3(C4CCN(S(=O)(=O)c5cccc6ccccc56)CC4)NC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C28H28N4O6S/c1-38-21-9-10-23-19(15-21)16-31(25(23)33)17-28(26(34)29-27(35)30-28)20-11-13-32(14-12-20)39(36,37)24-8-4-6-18-5-2-3-7-22(18)24/h2-10,15-16,20,33H,11-14,17H2,1H3,(H2,29,30,34,35) |
| InChIKey | XWWPZZJQUHARES-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|