C21H15Cl2N3O4 — CID 91520006
(5R)-5-[2-(3,5-dichlorophenyl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 91520006) has the molecular formula C21H15Cl2N3O4 and a molecular weight of 444.27 g/mol. Its IUPAC name is (5R)-5-[2-(3,5-dichlorophenyl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(3,5-dichlorophenyl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91520006 |
| Molecular Formula | C21H15Cl2N3O4 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (5R)-5-[2-(3,5-dichlorophenyl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4cc(Cl)cc(Cl)c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C21H15Cl2N3O4/c1-30-16-3-2-13-10-26(18(27)17(13)9-16)11-21(19(28)24-20(29)25-21)5-4-12-6-14(22)8-15(23)7-12/h2-3,6-10,27H,11H2,1H3,(H2,24,25,28,29)/t21-/m1/s1 |
| InChIKey | XVTOVQSEBMQVAB-OAQYLSRUSA-N |
| XLogP | 3.29 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|