C22H17N3O6 — CID 90980933
4-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzoic acid (PubChem CID 90980933) has the molecular formula C22H17N3O6 and a molecular weight of 419.39 g/mol. Its IUPAC name is 4-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 90980933 |
| Molecular Formula | C22H17N3O6 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzoic acid |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc(C(=O)O)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C22H17N3O6/c1-31-16-7-6-15-11-25(18(26)17(15)10-16)12-22(20(29)23-21(30)24-22)9-8-13-2-4-14(5-3-13)19(27)28/h2-7,10-11,26H,12H2,1H3,(H,27,28)(H2,23,24,29,30)/t22-/m1/s1 |
| InChIKey | GGIPWYVEFGBHKC-JOCHJYFZSA-N |
| XLogP | 1.68 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|