C23H16N4O6 — CID 91369345
5-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]isoindole-1,3-dione (PubChem CID 91369345) has the molecular formula C23H16N4O6 and a molecular weight of 444.40 g/mol. Its IUPAC name is 5-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]isoindole-1,3-dione.
| Compound Name | 5-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91369345 |
| Molecular Formula | C23H16N4O6 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 5-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]isoindole-1,3-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc5c(c4)C(=O)NC5=O)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C23H16N4O6/c1-33-14-4-3-13-10-27(20(30)16(13)9-14)11-23(21(31)25-22(32)26-23)7-6-12-2-5-15-17(8-12)19(29)24-18(15)28/h2-5,8-10,30H,11H2,1H3,(H,24,28,29)(H2,25,26,31,32)/t23-/m1/s1 |
| InChIKey | XZTCCENIUOCGJG-HSZRJFAPSA-N |
| XLogP | 0.87 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|