C23H22N4O4 — CID 91432973
(5R)-5-[2-[4-[(1S)-1-aminoethyl]phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 91432973) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is (5R)-5-[2-[4-[(1S)-1-aminoethyl]phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-[(1S)-1-aminoethyl]phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91432973 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (5R)-5-[2-[4-[(1S)-1-aminoethyl]phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc([C@H](C)N)cc4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C23H22N4O4/c1-14(24)16-5-3-15(4-6-16)9-10-23(21(29)25-22(30)26-23)13-27-12-17-7-8-18(31-2)11-19(17)20(27)28/h3-8,11-12,14,28H,13,24H2,1-2H3,(H2,25,26,29,30)/t14-,23+/m0/s1 |
| InChIKey | QLNWPINZXAFUEY-LFVRLGFBSA-N |
| XLogP | 2.01 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|