C24H22N4O5 — CID 90968750
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 90968750) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90968750 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | CON=C(C)c1ccc(C#C[C@]2(Cn3cc4ccc(OC)cc4c3O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C24H22N4O5/c1-15(27-33-3)17-6-4-16(5-7-17)10-11-24(22(30)25-23(31)26-24)14-28-13-18-8-9-19(32-2)12-20(18)21(28)29/h4-9,12-13,29H,14H2,1-3H3,(H2,25,26,30,31)/t24-/m1/s1 |
| InChIKey | OTPMZNSFKQQUCJ-XMMPIXPASA-N |
| XLogP | 2.36 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|