C23H18N4O5 — CID 91049606
(5R)-5-[2-(1-hydroxy-2H-isoindol-5-yl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 91049606) has the molecular formula C23H18N4O5 and a molecular weight of 430.42 g/mol. Its IUPAC name is (5R)-5-[2-(1-hydroxy-2H-isoindol-5-yl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(1-hydroxy-2H-isoindol-5-yl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91049606 |
| Molecular Formula | C23H18N4O5 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | (5R)-5-[2-(1-hydroxy-2H-isoindol-5-yl)ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc5c(O)[nH]cc5c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C23H18N4O5/c1-32-16-4-3-14-11-27(20(29)18(14)9-16)12-23(21(30)25-22(31)26-23)7-6-13-2-5-17-15(8-13)10-24-19(17)28/h2-5,8-11,24,28-29H,12H2,1H3,(H2,25,26,30,31)/t23-/m1/s1 |
| InChIKey | ACFSDYKOLBUNDG-HSZRJFAPSA-N |
| XLogP | 2.17 |
| TPSA | 128.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|