C23H17N5O5 — CID 91542439
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(7-oxo-8H-1,8-naphthyridin-3-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 91542439) has the molecular formula C23H17N5O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(7-oxo-8H-1,8-naphthyridin-3-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(7-oxo-8H-1,8-naphthyridin-3-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91542439 |
| Molecular Formula | C23H17N5O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(7-oxo-8H-1,8-naphthyridin-3-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4cnc5[nH]c(=O)ccc5c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C23H17N5O5/c1-33-16-4-2-15-11-28(20(30)17(15)9-16)12-23(21(31)26-22(32)27-23)7-6-13-8-14-3-5-18(29)25-19(14)24-10-13/h2-5,8-11,30H,12H2,1H3,(H,24,25,29)(H2,26,27,31,32)/t23-/m1/s1 |
| InChIKey | LBQFPRLBEBAHBA-HSZRJFAPSA-N |
| XLogP | 1.22 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|