C24H17N7O4 — CID 91120510
2-amino-6-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-1,8-naphthyridine-3-carbonitrile (PubChem CID 91120510) has the molecular formula C24H17N7O4 and a molecular weight of 467.45 g/mol. Its IUPAC name is 2-amino-6-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 2-amino-6-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 91120510 |
| Molecular Formula | C24H17N7O4 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-amino-6-[2-[(4R)-4-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-1,8-naphthyridine-3-carbonitrile |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4cnc5nc(N)c(C#N)cc5c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C24H17N7O4/c1-35-17-3-2-14-11-31(21(32)18(14)8-17)12-24(22(33)29-23(34)30-24)5-4-13-6-15-7-16(9-25)19(26)28-20(15)27-10-13/h2-3,6-8,10-11,32H,12H2,1H3,(H2,26,27,28)(H2,29,30,33,34)/t24-/m1/s1 |
| InChIKey | CYOWFUXEZOXTMP-XMMPIXPASA-N |
| XLogP | 1.38 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|