C18H14N4O4S — CID 91507011
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 91507011) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91507011 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(1,3-thiazol-2-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4nccs4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C18H14N4O4S/c1-26-12-3-2-11-9-22(15(23)13(11)8-12)10-18(16(24)20-17(25)21-18)5-4-14-19-6-7-27-14/h2-3,6-9,23H,10H2,1H3,(H2,20,21,24,25)/t18-/m1/s1 |
| InChIKey | GMIWASYWRKFKFW-GOSISDBHSA-N |
| XLogP | 1.44 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|