C22H18N6O4 — CID 91171716
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(5-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 91171716) has the molecular formula C22H18N6O4 and a molecular weight of 430.42 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(5-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(5-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91171716 |
| Molecular Formula | C22H18N6O4 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-(5-methyl-1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4cc5[nH]cnc5nc4C)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C22H18N6O4/c1-12-13(7-17-18(25-12)24-11-23-17)5-6-22(20(30)26-21(31)27-22)10-28-9-14-3-4-15(32-2)8-16(14)19(28)29/h3-4,7-9,11,29H,10H2,1-2H3,(H,23,24,25)(H2,26,27,30,31)/t22-/m1/s1 |
| InChIKey | XCKAYNCQXCWDIJ-JOCHJYFZSA-N |
| XLogP | 1.57 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|