C24H20N6O4 — CID 90956074
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(2-methylimidazol-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 90956074) has the molecular formula C24H20N6O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(2-methylimidazol-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(2-methylimidazol-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90956074 |
| Molecular Formula | C24H20N6O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(2-methylimidazol-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4cncc(-n5ccnc5C)c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C24H20N6O4/c1-15-26-7-8-30(15)18-9-16(11-25-12-18)5-6-24(22(32)27-23(33)28-24)14-29-13-17-3-4-19(34-2)10-20(17)21(29)31/h3-4,7-13,31H,14H2,1-2H3,(H2,27,28,32,33)/t24-/m1/s1 |
| InChIKey | KSTAPQKNBKZJQJ-XMMPIXPASA-N |
| XLogP | 1.87 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|