C21H16FN5O3 — CID 91441317
(5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1H-imidazol-2-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 91441317) has the molecular formula C21H16FN5O3 and a molecular weight of 405.39 g/mol. Its IUPAC name is (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1H-imidazol-2-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1H-imidazol-2-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91441317 |
| Molecular Formula | C21H16FN5O3 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(1H-imidazol-2-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3ncc[nH]3)cc2)N1 |
| InChI | InChI=1S/C21H16FN5O3/c22-15-6-3-13-10-27(18(28)16(13)9-15)11-21(19(29)25-20(30)26-21)14-4-1-12(2-5-14)17-23-7-8-24-17/h1-10,28H,11H2,(H,23,24)(H2,25,26,29,30)/t21-/m0/s1 |
| InChIKey | DHWRAORBWWDICL-NRFANRHFSA-N |
| XLogP | 2.61 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|