C18H12Cl2FN3O3 — CID 91116411
5-[(5,6-dichloro-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 91116411) has the molecular formula C18H12Cl2FN3O3 and a molecular weight of 408.22 g/mol. Its IUPAC name is 5-[(5,6-dichloro-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(5,6-dichloro-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91116411 |
| Molecular Formula | C18H12Cl2FN3O3 |
| Molecular Weight | 408.22 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 5-[(5,6-dichloro-1-hydroxyisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3cc(Cl)c(Cl)cc3c2O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C18H12Cl2FN3O3/c19-13-5-9-7-24(15(25)12(9)6-14(13)20)8-18(16(26)22-17(27)23-18)10-1-3-11(21)4-2-10/h1-7,25H,8H2,(H2,22,23,26,27) |
| InChIKey | LZNPPKPCPDSNQQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|