C18H13FIN3O4 — CID 91252035
5-[(1,5-dihydroxy-4-iodoisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 91252035) has the molecular formula C18H13FIN3O4 and a molecular weight of 481.22 g/mol. Its IUPAC name is 5-[(1,5-dihydroxy-4-iodoisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(1,5-dihydroxy-4-iodoisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91252035 |
| Molecular Formula | C18H13FIN3O4 |
| Molecular Weight | 481.22 g/mol |
| Exact Mass | 480.99 |
| IUPAC Name | 5-[(1,5-dihydroxy-4-iodoisoindol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3c(I)c(O)ccc3c2O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C18H13FIN3O4/c19-10-3-1-9(2-4-10)18(16(26)21-17(27)22-18)8-23-7-12-11(15(23)25)5-6-13(24)14(12)20/h1-7,24-25H,8H2,(H2,21,22,26,27) |
| InChIKey | QOOLNZQYVINBGN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|