C18H12F3N3O3 — CID 90707302
5-(2,4-difluorophenyl)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90707302) has the molecular formula C18H12F3N3O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-difluorophenyl)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90707302 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-(2,4-difluorophenyl)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3ccc(F)cc3c2O)(c2ccc(F)cc2F)N1 |
| InChI | InChI=1S/C18H12F3N3O3/c19-10-2-1-9-7-24(15(25)12(9)5-10)8-18(16(26)22-17(27)23-18)13-4-3-11(20)6-14(13)21/h1-7,25H,8H2,(H2,22,23,26,27) |
| InChIKey | ZSICGZPLJSPFEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|