C24H18FN3O4 — CID 90740839
(5R)-5-[(1,5-dihydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione (PubChem CID 90740839) has the molecular formula C24H18FN3O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is (5R)-5-[(1,5-dihydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1,5-dihydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90740839 |
| Molecular Formula | C24H18FN3O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (5R)-5-[(1,5-dihydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3cc(O)ccc3c2O)(c2ccc(-c3ccc(F)cc3)cc2)N1 |
| InChI | InChI=1S/C24H18FN3O4/c25-18-7-3-15(4-8-18)14-1-5-17(6-2-14)24(22(31)26-23(32)27-24)13-28-12-16-11-19(29)9-10-20(16)21(28)30/h1-12,29-30H,13H2,(H2,26,27,31,32)/t24-/m0/s1 |
| InChIKey | QAXVCNHIXGKXFV-DEOSSOPVSA-N |
| XLogP | 3.59 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|