C17H12F2N4O3 — CID 90697260
(5S)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(5-fluoro-2-pyridinyl)imidazolidine-2,4-dione (PubChem CID 90697260) has the molecular formula C17H12F2N4O3 and a molecular weight of 358.30 g/mol. Its IUPAC name is (5S)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(5-fluoro-2-pyridinyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(5-fluoro-2-pyridinyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90697260 |
| Molecular Formula | C17H12F2N4O3 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (5S)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(5-fluoro-2-pyridinyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(F)cc3c2O)(c2ccc(F)cn2)N1 |
| InChI | InChI=1S/C17H12F2N4O3/c18-10-2-1-9-7-23(14(24)12(9)5-10)8-17(15(25)21-16(26)22-17)13-4-3-11(19)6-20-13/h1-7,24H,8H2,(H2,21,22,25,26)/t17-/m0/s1 |
| InChIKey | UZQJZPLLMSMROL-KRWDZBQOSA-N |
| XLogP | 1.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|