C23H16ClFN4O3 — CID 90759376
(5S)-5-[4-(2-chloro-4-pyridinyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90759376) has the molecular formula C23H16ClFN4O3 and a molecular weight of 450.86 g/mol. Its IUPAC name is (5S)-5-[4-(2-chloro-4-pyridinyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[4-(2-chloro-4-pyridinyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90759376 |
| Molecular Formula | C23H16ClFN4O3 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (5S)-5-[4-(2-chloro-4-pyridinyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@](Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3ccnc(Cl)c3)cc2)N1 |
| InChI | InChI=1S/C23H16ClFN4O3/c24-19-9-14(7-8-26-19)13-1-4-16(5-2-13)23(21(31)27-22(32)28-23)12-29-11-15-3-6-17(25)10-18(15)20(29)30/h1-11,30H,12H2,(H2,27,28,31,32)/t23-/m1/s1 |
| InChIKey | UDBNOKLMXKPUNO-HSZRJFAPSA-N |
| XLogP | 3.94 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|