C21H17F4N3O3 — CID 90790489
5-(4-fluorophenyl)-5-[[1-hydroxy-6-(3,3,3-trifluoropropyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 90790489) has the molecular formula C21H17F4N3O3 and a molecular weight of 435.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(3,3,3-trifluoropropyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(3,3,3-trifluoropropyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90790489 |
| Molecular Formula | C21H17F4N3O3 |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(3,3,3-trifluoropropyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3ccc(CCC(F)(F)F)cc3c2O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C21H17F4N3O3/c22-15-5-3-14(4-6-15)20(18(30)26-19(31)27-20)11-28-10-13-2-1-12(7-8-21(23,24)25)9-16(13)17(28)29/h1-6,9-10,29H,7-8,11H2,(H2,26,27,30,31) |
| InChIKey | WDUJGORENPAIRR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|