C23H16ClFN4O4 — CID 90750580
5-[4-(5-chloro-6-oxo-1H-pyridin-3-yl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90750580) has the molecular formula C23H16ClFN4O4 and a molecular weight of 466.86 g/mol. Its IUPAC name is 5-[4-(5-chloro-6-oxo-1H-pyridin-3-yl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-(5-chloro-6-oxo-1H-pyridin-3-yl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90750580 |
| Molecular Formula | C23H16ClFN4O4 |
| Molecular Weight | 466.86 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 5-[4-(5-chloro-6-oxo-1H-pyridin-3-yl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3c[nH]c(=O)c(Cl)c3)cc2)N1 |
| InChI | InChI=1S/C23H16ClFN4O4/c24-18-7-14(9-26-19(18)30)12-1-4-15(5-2-12)23(21(32)27-22(33)28-23)11-29-10-13-3-6-16(25)8-17(13)20(29)31/h1-10,31H,11H2,(H,26,30)(H2,27,28,32,33) |
| InChIKey | CMVWDNJVWAFPAQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|