C24H17ClFN3O3 — CID 90782383
(5R)-5-[(6-chloro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione (PubChem CID 90782383) has the molecular formula C24H17ClFN3O3 and a molecular weight of 449.87 g/mol. Its IUPAC name is (5R)-5-[(6-chloro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-chloro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90782383 |
| Molecular Formula | C24H17ClFN3O3 |
| Molecular Weight | 449.87 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (5R)-5-[(6-chloro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-fluorophenyl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(Cl)cc3c2O)(c2ccc(-c3ccc(F)cc3)cc2)N1 |
| InChI | InChI=1S/C24H17ClFN3O3/c25-18-8-3-16-12-29(21(30)20(16)11-18)13-24(22(31)27-23(32)28-24)17-6-1-14(2-7-17)15-4-9-19(26)10-5-15/h1-12,30H,13H2,(H2,27,28,31,32)/t24-/m0/s1 |
| InChIKey | XWDFCYZCEHPCRY-DEOSSOPVSA-N |
| XLogP | 4.54 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|