C25H17F4N3O3 — CID 90816797
(5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-[4-(trifluoromethyl)phenyl]phenyl]imidazolidine-2,4-dione (PubChem CID 90816797) has the molecular formula C25H17F4N3O3 and a molecular weight of 483.42 g/mol. Its IUPAC name is (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-[4-(trifluoromethyl)phenyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-[4-(trifluoromethyl)phenyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90816797 |
| Molecular Formula | C25H17F4N3O3 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-[4-(trifluoromethyl)phenyl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)N1 |
| InChI | InChI=1S/C25H17F4N3O3/c26-19-10-5-16-12-32(21(33)20(16)11-19)13-24(22(34)30-23(35)31-24)17-6-1-14(2-7-17)15-3-8-18(9-4-15)25(27,28)29/h1-12,33H,13H2,(H2,30,31,34,35)/t24-/m0/s1 |
| InChIKey | JYJOSJLCNNVOLS-DEOSSOPVSA-N |
| XLogP | 4.91 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|