C19H13F4N3O3 — CID 90780342
5-(4-fluorophenyl)-5-[[1-hydroxy-6-(trifluoromethyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 90780342) has the molecular formula C19H13F4N3O3 and a molecular weight of 407.32 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(trifluoromethyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(trifluoromethyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90780342 |
| Molecular Formula | C19H13F4N3O3 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 5-(4-fluorophenyl)-5-[[1-hydroxy-6-(trifluoromethyl)isoindol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3ccc(C(F)(F)F)cc3c2O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C19H13F4N3O3/c20-13-5-3-11(4-6-13)18(16(28)24-17(29)25-18)9-26-8-10-1-2-12(19(21,22)23)7-14(10)15(26)27/h1-8,27H,9H2,(H2,24,25,28,29) |
| InChIKey | UYLJWSOKVUAKAX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|