C22H15F4N3O4 — CID 90759681
(5R)-5-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90759681) has the molecular formula C22H15F4N3O4 and a molecular weight of 461.37 g/mol. Its IUPAC name is (5R)-5-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90759681 |
| Molecular Formula | C22H15F4N3O4 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (5R)-5-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethynyl]-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(C#Cc4ccc(F)c(C(F)(F)F)c4)NC(=O)NC3=O)c(O)c2c1 |
| InChI | InChI=1S/C22H15F4N3O4/c1-33-14-4-3-13-10-29(18(30)15(13)9-14)11-21(19(31)27-20(32)28-21)7-6-12-2-5-17(23)16(8-12)22(24,25)26/h2-5,8-10,30H,11H2,1H3,(H2,27,28,31,32)/t21-/m1/s1 |
| InChIKey | CWDUSXZKSSKSFP-OAQYLSRUSA-N |
| XLogP | 3.14 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|