C24H16F3N3O3 — CID 90791387
(5R)-5-[4-(2,4-difluorophenyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 90791387) has the molecular formula C24H16F3N3O3 and a molecular weight of 451.40 g/mol. Its IUPAC name is (5R)-5-[4-(2,4-difluorophenyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(2,4-difluorophenyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90791387 |
| Molecular Formula | C24H16F3N3O3 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (5R)-5-[4-(2,4-difluorophenyl)phenyl]-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3ccc(F)cc3F)cc2)N1 |
| InChI | InChI=1S/C24H16F3N3O3/c25-16-6-3-14-11-30(21(31)19(14)9-16)12-24(22(32)28-23(33)29-24)15-4-1-13(2-5-15)18-8-7-17(26)10-20(18)27/h1-11,31H,12H2,(H2,28,29,32,33)/t24-/m0/s1 |
| InChIKey | VJVOCXPSMOXKOB-DEOSSOPVSA-N |
| XLogP | 4.17 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|