C29H38N4O6Si — CID 71167419
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-morpholin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 71167419) has the molecular formula C29H38N4O6Si and a molecular weight of 566.73 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-morpholin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-morpholin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71167419 |
| Molecular Formula | C29H38N4O6Si |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-morpholin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(N4CCOCC4)cc3)NC(=O)N(COCC[Si](C)(C)C)C1=O)C2 |
| InChI | InChI=1S/C29H38N4O6Si/c1-37-24-10-5-21-18-32(26(34)25(21)17-24)19-29(22-6-8-23(9-7-22)31-11-13-38-14-12-31)27(35)33(28(36)30-29)20-39-15-16-40(2,3)4/h5-10,17H,11-16,18-20H2,1-4H3,(H,30,36)/t29-/m0/s1 |
| InChIKey | BAWSYMXOQVJUSV-LJAQVGFWSA-N |
| XLogP | 3.25 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|