C25H30BrN3O5Si — CID 90981559
(5R)-5-(4-bromophenyl)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 90981559) has the molecular formula C25H30BrN3O5Si and a molecular weight of 560.52 g/mol. Its IUPAC name is (5R)-5-(4-bromophenyl)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-bromophenyl)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90981559 |
| Molecular Formula | C25H30BrN3O5Si |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | (5R)-5-(4-bromophenyl)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2cn(C[C@@]3(c4ccc(Br)cc4)NC(=O)N(COCC[Si](C)(C)C)C3=O)c(O)c2c1 |
| InChI | InChI=1S/C25H30BrN3O5Si/c1-33-20-10-5-17-14-28(22(30)21(17)13-20)15-25(18-6-8-19(26)9-7-18)23(31)29(24(32)27-25)16-34-11-12-35(2,3)4/h5-10,13-14,30H,11-12,15-16H2,1-4H3,(H,27,32)/t25-/m0/s1 |
| InChIKey | UVBIBSNUROMYGV-VWLOTQADSA-N |
| XLogP | 4.88 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|