C25H31N3O5Si — CID 58053193
(5R)-5-[[3-oxo-5-(trideuteriomethoxy)-1H-isoindol-2-yl]methyl]-5-phenyl-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 58053193) has the molecular formula C25H31N3O5Si and a molecular weight of 484.64 g/mol. Its IUPAC name is (5R)-5-[[3-oxo-5-(trideuteriomethoxy)-1H-isoindol-2-yl]methyl]-5-phenyl-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[3-oxo-5-(trideuteriomethoxy)-1H-isoindol-2-yl]methyl]-5-phenyl-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58053193 |
| Molecular Formula | C25H31N3O5Si |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (5R)-5-[[3-oxo-5-(trideuteriomethoxy)-1H-isoindol-2-yl]methyl]-5-phenyl-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])Oc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccccc3)NC(=O)N(COCC[Si](C)(C)C)C1=O)C2 |
| InChI | InChI=1S/C25H31N3O5Si/c1-32-20-11-10-18-15-27(22(29)21(18)14-20)16-25(19-8-6-5-7-9-19)23(30)28(24(31)26-25)17-33-12-13-34(2,3)4/h5-11,14H,12-13,15-17H2,1-4H3,(H,26,31)/t25-/m0/s1/i1D3 |
| InChIKey | QSKNMSNTICJLMJ-PWQFMXDESA-N |
| XLogP | 3.41 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|