C27H30N4O8 — CID 46190105
(5S)-5-furo[3,2-c]pyridin-2-yl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 46190105) has the molecular formula C27H30N4O8 and a molecular weight of 538.56 g/mol. Its IUPAC name is (5S)-5-furo[3,2-c]pyridin-2-yl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-furo[3,2-c]pyridin-2-yl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46190105 |
| Molecular Formula | C27H30N4O8 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (5S)-5-furo[3,2-c]pyridin-2-yl-3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COCCOCCOCCN1C(=O)N[C@@](CN2Cc3ccc(OC)cc3C2=O)(c2cc3cnccc3o2)C1=O |
| InChI | InChI=1S/C27H30N4O8/c1-35-9-10-38-12-11-37-8-7-31-25(33)27(29-26(31)34,23-13-19-15-28-6-5-22(19)39-23)17-30-16-18-3-4-20(36-2)14-21(18)24(30)32/h3-6,13-15H,7-12,16-17H2,1-2H3,(H,29,34)/t27-/m0/s1 |
| InChIKey | KSWTWYZAKCRKGX-MHZLTWQESA-N |
| XLogP | 1.92 |
| TPSA | 132.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|