C22H19N5O5 — CID 91344128
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-[(methylideneamino)methyl]furo[3,2-c]pyridin-2-yl]imidazolidine-2,4-dione (PubChem CID 91344128) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-[(methylideneamino)methyl]furo[3,2-c]pyridin-2-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-[(methylideneamino)methyl]furo[3,2-c]pyridin-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91344128 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[6-[(methylideneamino)methyl]furo[3,2-c]pyridin-2-yl]imidazolidine-2,4-dione |
| SMILES | C=NCc1cc2oc(C3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2cn1 |
| InChI | InChI=1S/C22H19N5O5/c1-23-9-14-6-17-13(8-24-14)5-18(32-17)22(20(29)25-21(30)26-22)11-27-10-12-3-4-15(31-2)7-16(12)19(27)28/h3-8H,1,9-11H2,2H3,(H2,25,26,29,30) |
| InChIKey | JPEKKRJOABGHSE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|