C24H22N4O6 — CID 58053132
(5S)-5-[5-(1-ethoxyethenyl)furo[2,3-b]pyridin-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 58053132) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is (5S)-5-[5-(1-ethoxyethenyl)furo[2,3-b]pyridin-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[5-(1-ethoxyethenyl)furo[2,3-b]pyridin-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58053132 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (5S)-5-[5-(1-ethoxyethenyl)furo[2,3-b]pyridin-2-yl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C=C(OCC)c1cnc2oc([C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C24H22N4O6/c1-4-33-13(2)16-7-15-8-19(34-20(15)25-10-16)24(22(30)26-23(31)27-24)12-28-11-14-5-6-17(32-3)9-18(14)21(28)29/h5-10H,2,4,11-12H2,1,3H3,(H2,26,27,30,31)/t24-/m0/s1 |
| InChIKey | CPVSMKQLJMSATP-DEOSSOPVSA-N |
| XLogP | 2.53 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|