C25H26N6O5 — CID 70235435
(5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[5-[1-[2-(methylamino)ethylamino]ethenyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione (PubChem CID 70235435) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[5-[1-[2-(methylamino)ethylamino]ethenyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[5-[1-[2-(methylamino)ethylamino]ethenyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70235435 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (5S)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[5-[1-[2-(methylamino)ethylamino]ethenyl]furo[3,2-b]pyridin-2-yl]imidazolidine-2,4-dione |
| SMILES | C=C(NCCNC)c1ccc2oc([C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2n1 |
| InChI | InChI=1S/C25H26N6O5/c1-14(27-9-8-26-2)18-6-7-20-19(28-18)11-21(36-20)25(23(33)29-24(34)30-25)13-31-12-15-4-5-16(35-3)10-17(15)22(31)32/h4-7,10-11,26-27H,1,8-9,12-13H2,2-3H3,(H2,29,30,33,34)/t25-/m0/s1 |
| InChIKey | DRTMYMVHPDAESA-VWLOTQADSA-N |
| XLogP | 1.31 |
| TPSA | 137.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|