C24H24N6O5 — CID 77403584
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione (PubChem CID 77403584) has the molecular formula C24H24N6O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 77403584 |
| Molecular Formula | C24H24N6O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3cc4nc(N5CCNCC5)ccc4o3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C24H24N6O5/c1-34-15-3-2-14-12-30(21(31)16(14)10-15)13-24(22(32)27-23(33)28-24)19-11-17-18(35-19)4-5-20(26-17)29-8-6-25-7-9-29/h2-5,10-11,25H,6-9,12-13H2,1H3,(H2,27,28,32,33) |
| InChIKey | WNMBFEGQCDGWCM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|