C25H28N6O5 — CID 143990599
6-methoxy-2-methyl-3H-isoindol-1-one;5-methyl-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione (PubChem CID 143990599) has the molecular formula C25H28N6O5 and a molecular weight of 492.54 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3H-isoindol-1-one;5-methyl-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-methyl-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143990599 |
| Molecular Formula | C25H28N6O5 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 6-methoxy-2-methyl-3H-isoindol-1-one;5-methyl-5-(5-piperazin-1-ylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
| SMILES | CC1(c2cc3nc(N4CCNCC4)ccc3o2)NC(=O)NC1=O.COc1ccc2c(c1)C(=O)N(C)C2 |
| InChI | InChI=1S/C15H17N5O3.C10H11NO2/c1-15(13(21)18-14(22)19-15)11-8-9-10(23-11)2-3-12(17-9)20-6-4-16-5-7-20;1-11-6-7-3-4-8(13-2)5-9(7)10(11)12/h2-3,8,16H,4-7H2,1H3,(H2,18,19,21,22);3-5H,6H2,1-2H3 |
| InChIKey | HURVLUIYMGJEHT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|